|
CAS#: 83767-03-7 Product: 2-(Dimethylamino)-8-Phenyl-4H-1-Benzopyran-4-One No suppilers available for the product. |
| Name | 2-(Dimethylamino)-8-Phenyl-4H-1-Benzopyran-4-One |
|---|---|
| Synonyms | 2-Dimethylamino-8-Phenyl-Chromen-4-One; 2-Dimethylamino-8-Phenyl-4-Chromenone; 2-Dimethylamino-8-Phenyl-Chromone |
| Molecular Structure | ![]() |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 |
| CAS Registry Number | 83767-03-7 |
| SMILES | C2=C(C1=C(C(C=C(O1)N(C)C)=O)C=C2)C3=CC=CC=C3 |
| InChI | 1S/C17H15NO2/c1-18(2)16-11-15(19)14-10-6-9-13(17(14)20-16)12-7-4-3-5-8-12/h3-11H,1-2H3 |
| InChIKey | QUITTZPTEMTSCS-UHFFFAOYSA-N |
| Density | 1.231g/cm3 (Cal.) |
|---|---|
| Boiling point | 419.091°C at 760 mmHg (Cal.) |
| Flash point | 207.259°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Dimethylamino)-8-Phenyl-4H-1-Benzopyran-4-One |