|
CAS#: 83783-84-0 Product: 2-Furylmethyl 2-Methylcrotonate No suppilers available for the product. |
| Name | 2-Furylmethyl 2-Methylcrotonate |
|---|---|
| Synonyms | 2-Furylmethyl (E)-2-Methylbut-2-Enoate; (E)-2-Methylbut-2-Enoic Acid 2-Furylmethyl Ester; 2-Furylmethyl 2-Methylcrotonate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 |
| CAS Registry Number | 83783-84-0 |
| EINECS | 280-818-4 |
| SMILES | C1=CC=C(O1)COC(=O)C(=C/C)/C |
| InChI | 1S/C10H12O3/c1-3-8(2)10(11)13-7-9-5-4-6-12-9/h3-6H,7H2,1-2H3/b8-3+ |
| InChIKey | WCLYKOBJVINYIY-FPYGCLRLSA-N |
| Density | 1.073g/cm3 (Cal.) |
|---|---|
| Boiling point | 238.596°C at 760 mmHg (Cal.) |
| Flash point | 98.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Furylmethyl 2-Methylcrotonate |