|
CAS#: 83800-17-3 Product: Triacetoxyphenylpyruvic Acid No suppilers available for the product. |
| Name | Triacetoxyphenylpyruvic Acid |
|---|---|
| Synonyms | (Z)-2-Acetoxy-3-(3,4-Diacetoxyphenyl)Prop-2-Enoic Acid; (Z)-2-Acetoxy-3-(3,4-Diacetoxyphenyl)Acrylic Acid; Tappa |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14O8 |
| Molecular Weight | 322.27 |
| CAS Registry Number | 83800-17-3 |
| SMILES | C1=C(C(=CC=C1/C=C(/C(=O)O)OC(=O)C)OC(=O)C)OC(=O)C |
| InChI | 1S/C15H14O8/c1-8(16)21-12-5-4-11(6-13(12)22-9(2)17)7-14(15(19)20)23-10(3)18/h4-7H,1-3H3,(H,19,20)/b14-7- |
| InChIKey | JIHNMDCGGTVLQA-AUWJEWJLSA-N |
| Density | 1.362g/cm3 (Cal.) |
|---|---|
| Boiling point | 489.542°C at 760 mmHg (Cal.) |
| Flash point | 179.809°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Triacetoxyphenylpyruvic Acid |