|
CAS#: 83801-01-8 Product: 3-(2,3-Dihydroxyphenyl)Butyric Acid No suppilers available for the product. |
| Name | 3-(2,3-Dihydroxyphenyl)Butyric Acid |
|---|---|
| Synonyms | 3-(2,3-Dihydroxyphenyl)Butyric Acid; 2,3-Dihydroxyphenylbutyrate; Benzenepropanoic Acid, 2,3-Dihydroxy-Beta-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 |
| CAS Registry Number | 83801-01-8 |
| SMILES | C1=C(C(=C(O)C=C1)O)C(CC(=O)O)C |
| InChI | 1S/C10H12O4/c1-6(5-9(12)13)7-3-2-4-8(11)10(7)14/h2-4,6,11,14H,5H2,1H3,(H,12,13) |
| InChIKey | ZMUTWNYECYKYQF-UHFFFAOYSA-N |
| Density | 1.33g/cm3 (Cal.) |
|---|---|
| Boiling point | 397.3°C at 760 mmHg (Cal.) |
| Flash point | 208.243°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(2,3-Dihydroxyphenyl)Butyric Acid |