|
CAS#: 83803-57-0 Product: 3-Bromo-6-Chloro-2-Methoxytoluene No suppilers available for the product. |
| Name | 3-Bromo-6-Chloro-2-Methoxytoluene |
|---|---|
| Synonyms | 1-Bromo-4-Chloro-2-Methoxy-3-Methyl-Benzene; 3-Bromo-6-Chloro-2-Methoxytoluene |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8BrClO |
| Molecular Weight | 235.51 |
| CAS Registry Number | 83803-57-0 |
| EINECS | 280-876-0 |
| SMILES | C1=C(Br)C(=C(C(=C1)Cl)C)OC |
| InChI | 1S/C8H8BrClO/c1-5-7(10)4-3-6(9)8(5)11-2/h3-4H,1-2H3 |
| InChIKey | JECXAFPZOCICOM-UHFFFAOYSA-N |
| Density | 1.492g/cm3 (Cal.) |
|---|---|
| Boiling point | 252.329°C at 760 mmHg (Cal.) |
| Flash point | 106.405°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Bromo-6-Chloro-2-Methoxytoluene |