|
CAS#: 83803-38-7 Product: 2-Butoxyethyl phenyl(1-piperidinyl)acetate hydrochloride (1:1) No suppilers available for the product. |
| Name | 2-Butoxyethyl phenyl(1-piperidinyl)acetate hydrochloride (1:1) |
|---|---|
| Synonyms | 2-butoxyethyl α-phenylpiperidine-1-acetate hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C19H30ClNO3 |
| Molecular Weight | 355.90 |
| CAS Registry Number | 83803-38-7 |
| EINECS | 280-855-6 |
| SMILES | Cl.O=C(OCCOCCCC)C(c1ccccc1)N2CCCCC2 |
| InChI | 1S/C19H29NO3.ClH/c1-2-3-14-22-15-16-23-19(21)18(17-10-6-4-7-11-17)20-12-8-5-9-13-20;/h4,6-7,10-11,18H,2-3,5,8-9,12-16H2,1H3;1H |
| InChIKey | FFROUYUBPKIUKJ-UHFFFAOYSA-N |
| Boiling point | 450.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 226.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Butoxyethyl phenyl(1-piperidinyl)acetate hydrochloride (1:1) |