|
CAS#: 83803-88-7 Product: 2-Hydroxy-4-Methoxy-3-Methylbenzophenone No suppilers available for the product. |
| Name | 2-Hydroxy-4-Methoxy-3-Methylbenzophenone |
|---|---|
| Synonyms | (2-Hydroxy-4-Methoxy-3-Methyl-Phenyl)-Phenyl-Methanone; 2-Hydroxy-4-Methoxy-3-Methylbenzophenone |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27 |
| CAS Registry Number | 83803-88-7 |
| EINECS | 280-908-3 |
| SMILES | C1=C(C(=C(C(=C1)OC)C)O)C(C2=CC=CC=C2)=O |
| InChI | 1S/C15H14O3/c1-10-13(18-2)9-8-12(14(10)16)15(17)11-6-4-3-5-7-11/h3-9,16H,1-2H3 |
| InChIKey | CUWRRXIHOSRXGN-UHFFFAOYSA-N |
| Density | 1.175g/cm3 (Cal.) |
|---|---|
| Boiling point | 385.586°C at 760 mmHg (Cal.) |
| Flash point | 143.654°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Hydroxy-4-Methoxy-3-Methylbenzophenone |