|
CAS#: 83817-54-3 Product: 2-[[4-(Carboxymethoxy)Phenyl]Thio]Benzoic Acid No suppilers available for the product. |
| Name | 2-[[4-(Carboxymethoxy)Phenyl]Thio]Benzoic Acid |
|---|---|
| Synonyms | 2-[[4-(Carboxymethyloxy)Phenyl]Thio]Benzoic Acid; 2-((4-(Carboxymethoxy)Phenyl)Thio)Benzoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C15H12O5S |
| Molecular Weight | 304.32 |
| CAS Registry Number | 83817-54-3 |
| EINECS | 280-954-4 |
| SMILES | C1=CC(=CC=C1SC2=C(C(=O)O)C=CC=C2)OCC(=O)O |
| InChI | 1S/C15H12O5S/c16-14(17)9-20-10-5-7-11(8-6-10)21-13-4-2-1-3-12(13)15(18)19/h1-8H,9H2,(H,16,17)(H,18,19) |
| InChIKey | OWYGKJBADUJXDE-UHFFFAOYSA-N |
| Density | 1.465g/cm3 (Cal.) |
|---|---|
| Boiling point | 532.242°C at 760 mmHg (Cal.) |
| Flash point | 275.69°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[[4-(Carboxymethoxy)Phenyl]Thio]Benzoic Acid |