|
CAS#: 83846-60-0 Product: 2-[Chloro(4-Fluorophenyl)Methylene]Butyraldehyde No suppilers available for the product. |
| Name | 2-[Chloro(4-Fluorophenyl)Methylene]Butyraldehyde |
|---|---|
| Synonyms | (2E)-2-[Chloro-(4-Fluorophenyl)Methylene]Butanal; (E)-3-Chloro-2-Ethyl-3-(4-Fluorophenyl)Acrolein; 2-(Chloro(4-Fluorophenyl)Methylene)Butyraldehyde |
| Molecular Structure | ![]() |
| Molecular Formula | C11H10ClFO |
| Molecular Weight | 212.65 |
| CAS Registry Number | 83846-60-0 |
| EINECS | 281-037-1 |
| SMILES | C1=C(F)C=CC(=C1)\C(Cl)=C(C=O)\CC |
| InChI | 1S/C11H10ClFO/c1-2-8(7-14)11(12)9-3-5-10(13)6-4-9/h3-7H,2H2,1H3/b11-8+ |
| InChIKey | ZGIFYCALAOVWQJ-DHZHZOJOSA-N |
| Density | 1.185g/cm3 (Cal.) |
|---|---|
| Boiling point | 284.007°C at 760 mmHg (Cal.) |
| Flash point | 125.563°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[Chloro(4-Fluorophenyl)Methylene]Butyraldehyde |