|
CAS#: 83850-00-4 Product: 1,3,5,6,7-Pentachloro-4-Hydroxybicyclo[3.2.0]Hepta-3,6-Dien-2-One No suppilers available for the product. |
| Name | 1,3,5,6,7-Pentachloro-4-Hydroxybicyclo[3.2.0]Hepta-3,6-Dien-2-One |
|---|---|
| Synonyms | 1,3,5,6,7-Pentachloro-2-Hydroxy-Bicyclo[3.2.0]Hepta-2,6-Dien-4-One; 1,3,5,6,7-Pentachloro-2-Hydroxy-4-Bicyclo[3.2.0]Hepta-2,6-Dienone; Nsc61929 |
| Molecular Structure | ![]() |
| Molecular Formula | C7HCl5O2 |
| Molecular Weight | 294.35 |
| CAS Registry Number | 83850-00-4 |
| SMILES | O=C2C1(C(C(=C1Cl)Cl)(C(=C2Cl)O)Cl)Cl |
| InChI | 1S/C7HCl5O2/c8-1-4(13)6(11)2(9)3(10)7(6,12)5(1)14/h13H |
| InChIKey | IINXNTXMSWMIMR-UHFFFAOYSA-N |
| Density | 2.009g/cm3 (Cal.) |
|---|---|
| Boiling point | 325.568°C at 760 mmHg (Cal.) |
| Flash point | 150.698°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,5,6,7-Pentachloro-4-Hydroxybicyclo[3.2.0]Hepta-3,6-Dien-2-One |