|
CAS#: 83863-77-8 Product: 6-(2-Chloroethyl)-3,7-dimethyl-5H-[1,3]thiazolo[3,2-a]pyrimidin-5-one No suppilers available for the product. |
| Name | 6-(2-Chloroethyl)-3,7-dimethyl-5H-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| Synonyms | 6-(2-chlo |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11ClN2OS |
| Molecular Weight | 242.73 |
| CAS Registry Number | 83863-77-8 |
| EINECS | 281-143-8 |
| SMILES | C\C1=C\S\C2=NC(/C)=C(/CCCl)C(=O)N12 |
| InChI | 1S/C10H11ClN2OS/c1-6-5-15-10-12-7(2)8(3-4-11)9(14)13(6)10/h5H,3-4H2,1-2H3 |
| InChIKey | MGWXSWNURQSQHA-UHFFFAOYSA-N |
| Density | 1.416g/cm3 (Cal.) |
|---|---|
| Boiling point | 362.1°C at 760 mmHg (Cal.) |
| Flash point | 172.792°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-(2-Chloroethyl)-3,7-dimethyl-5H-[1,3]thiazolo[3,2-a]pyrimidin-5-one |