|
CAS#: 83875-92-7 Product: 2,4,5-Tri-Tert-Butylphenol No suppilers available for the product. |
| Name | 2,4,5-Tri-Tert-Butylphenol |
|---|---|
| Synonyms | 2,4,5-Tri-Tert-Butylphenol |
| Molecular Structure | ![]() |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.43 |
| CAS Registry Number | 83875-92-7 |
| EINECS | 281-151-1 |
| SMILES | C1=C(C(C)(C)C)C(=CC(=C1O)C(C)(C)C)C(C)(C)C |
| InChI | 1S/C18H30O/c1-16(2,3)12-10-14(18(7,8)9)15(19)11-13(12)17(4,5)6/h10-11,19H,1-9H3 |
| InChIKey | XRXSBCHCLGSTHW-UHFFFAOYSA-N |
| Density | 0.911g/cm3 (Cal.) |
|---|---|
| Boiling point | 327.464°C at 760 mmHg (Cal.) |
| Flash point | 147.498°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,5-Tri-Tert-Butylphenol |