|
CAS#: 83890-47-5 Product: N,N-Diethyl-4-{(E)-[1-naphthyl(phenyl)hydrazono]methyl}aniline No suppilers available for the product. |
| Name | N,N-Diethyl-4-{(E)-[1-naphthyl(phenyl)hydrazono]methyl}aniline |
|---|---|
| Synonyms | 4-(diethylamino)benzaldehyde 1-naphthylphenylhydrazone |
| Molecular Structure | ![]() |
| Molecular Formula | C27H27N3 |
| Molecular Weight | 393.52 |
| CAS Registry Number | 83890-47-5 |
| EINECS | 281-178-9 |
| SMILES | CCN(CC)c1ccc(cc1)/C=N/N(c3cccc2ccccc23)c4ccccc4 |
| InChI | 1S/C27H27N3/c1-3-29(4-2)24-19-17-22(18-20-24)21-28-30(25-13-6-5-7-14-25)27-16-10-12-23-11-8-9-15-26(23)27/h5-21H,3-4H2,1-2H3/b28-21+ |
| InChIKey | SUJMFQYAKKPLSH-SGWCAAJKSA-N |
| Density | 1.043g/cm3 (Cal.) |
|---|---|
| Boiling point | 564.081°C at 760 mmHg (Cal.) |
| Flash point | 294.946°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Diethyl-4-{(E)-[1-naphthyl(phenyl)hydrazono]methyl}aniline |