|
CAS#: 83898-19-5 Product: 3-(3-Chloro-2-Hydroxyphenyl)-1,1-Dimethylurea No suppilers available for the product. |
| Name | 3-(3-Chloro-2-Hydroxyphenyl)-1,1-Dimethylurea |
|---|---|
| Synonyms | 3-(3-Chloro-2-Hydroxy-Phenyl)-1,1-Dimethyl-Urea |
| Molecular Structure | ![]() |
| Molecular Formula | C9H11ClN2O2 |
| Molecular Weight | 214.65 |
| CAS Registry Number | 83898-19-5 |
| EINECS | 281-227-4 |
| SMILES | C1=CC=C(Cl)C(=C1NC(=O)N(C)C)O |
| InChI | 1S/C9H11ClN2O2/c1-12(2)9(14)11-7-5-3-4-6(10)8(7)13/h3-5,13H,1-2H3,(H,11,14) |
| InChIKey | IFFCYOSBJAYENL-UHFFFAOYSA-N |
| Density | 1.37g/cm3 (Cal.) |
|---|---|
| Boiling point | 368.779°C at 760 mmHg (Cal.) |
| Flash point | 176.831°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(3-Chloro-2-Hydroxyphenyl)-1,1-Dimethylurea |