|
CAS#: 83898-37-7 Product: 3-(2-Hydroxy-3-Nitrophenyl)-1,1-Dimethylurea No suppilers available for the product. |
| Name | 3-(2-Hydroxy-3-Nitrophenyl)-1,1-Dimethylurea |
|---|---|
| Synonyms | 3-(2-Hydroxy-3-Nitro-Phenyl)-1,1-Dimethyl-Urea |
| Molecular Structure | ![]() |
| Molecular Formula | C9H11N3O4 |
| Molecular Weight | 225.20 |
| CAS Registry Number | 83898-37-7 |
| EINECS | 281-246-8 |
| SMILES | C1=C([N+]([O-])=O)C(=C(NC(=O)N(C)C)C=C1)O |
| InChI | 1S/C9H11N3O4/c1-11(2)9(14)10-6-4-3-5-7(8(6)13)12(15)16/h3-5,13H,1-2H3,(H,10,14) |
| InChIKey | LCECVJGHMHPVSW-UHFFFAOYSA-N |
| Density | 1.439g/cm3 (Cal.) |
|---|---|
| Boiling point | 383.327°C at 760 mmHg (Cal.) |
| Flash point | 185.63°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(2-Hydroxy-3-Nitrophenyl)-1,1-Dimethylurea |