|
CAS#: 83898-61-7 Product: 1,3-Bis(1,1-Dimethylethyl)-2-Naphthol No suppilers available for the product. |
| Name | 1,3-Bis(1,1-Dimethylethyl)-2-Naphthol |
|---|---|
| Synonyms | 1,3-Ditert-Butyl-2-Naphthalenol; 1,3-Ditert-Butyl-2-Naphthol; 1,3-Bis(1,1-Dimethylethyl)-2-Naphthol |
| Molecular Structure | ![]() |
| Molecular Formula | C18H24O |
| Molecular Weight | 256.39 |
| CAS Registry Number | 83898-61-7 |
| EINECS | 281-273-5 |
| SMILES | C1=C(C(C)(C)C)C(=C(C(C)(C)C)C2=C1C=CC=C2)O |
| InChI | 1S/C18H24O/c1-17(2,3)14-11-12-9-7-8-10-13(12)15(16(14)19)18(4,5)6/h7-11,19H,1-6H3 |
| InChIKey | QOXKLMBZSCTWLR-UHFFFAOYSA-N |
| Density | 1.004g/cm3 (Cal.) |
|---|---|
| Boiling point | 343.212°C at 760 mmHg (Cal.) |
| Flash point | 158.984°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Bis(1,1-Dimethylethyl)-2-Naphthol |