|
CAS#: 83918-56-3 Product: 2,3,5-Tribromo-4-Chloro-6-Methylphenol No suppilers available for the product. |
| Name | 2,3,5-Tribromo-4-Chloro-6-Methylphenol |
|---|---|
| Synonyms | 2,3,5-Tribromo-4-Chloro-6-Methyl-Phenol |
| Molecular Structure | ![]() |
| Molecular Formula | C7H4Br3ClO |
| Molecular Weight | 379.27 |
| CAS Registry Number | 83918-56-3 |
| EINECS | 281-290-8 |
| SMILES | CC1=C(Br)C(=C(Br)C(=C1O)Br)Cl |
| InChI | 1S/C7H4Br3ClO/c1-2-3(8)6(11)4(9)5(10)7(2)12/h12H,1H3 |
| InChIKey | DUSUUBJAFMIHQB-UHFFFAOYSA-N |
| Density | 2.304g/cm3 (Cal.) |
|---|---|
| Boiling point | 352.116°C at 760 mmHg (Cal.) |
| Flash point | 166.754°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,5-Tribromo-4-Chloro-6-Methylphenol |