|
CAS#: 83924-98-5 Product: Flavidin No suppilers available for the product. |
| Name | Flavidin |
|---|---|
| Synonyms | Flavidin; 5H-Phenanthro(4,5-Bcd)Pyran-2,7-Diol, 9,10-Dihydro- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.26 |
| CAS Registry Number | 83924-98-5 |
| SMILES | C4=C3C1=C(COC2=CC(=CC(=C12)CC3)O)C=C4O |
| InChI | 1S/C15H12O3/c16-11-3-8-1-2-9-4-12(17)6-13-15(9)14(8)10(5-11)7-18-13/h3-6,16-17H,1-2,7H2 |
| InChIKey | QMOLHJKSZMURCV-UHFFFAOYSA-N |
| Density | 1.453g/cm3 (Cal.) |
|---|---|
| Boiling point | 554.882°C at 760 mmHg (Cal.) |
| Flash point | 289.382°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Flavidin |