|
CAS#: 83929-32-2 Product: 1,1'-(4-Chloro-1-butene-1,1-diyl)bis(4-chlorobenzene) No suppilers available for the product. |
| Name | 1,1'-(4-Chloro-1-butene-1,1-diyl)bis(4-chlorobenzene) |
|---|---|
| Synonyms | 1,1'-(4-chloro-1-buten-1-ylidene)bis(4-chlorobenzene) |
| Molecular Structure | ![]() |
| Molecular Formula | C16H13Cl3 |
| Molecular Weight | 311.63 |
| CAS Registry Number | 83929-32-2 |
| EINECS | 281-327-8 |
| SMILES | Clc1ccc(cc1)C(=CCCCl)c2ccc(Cl)cc2 |
| InChI | 1S/C16H13Cl3/c17-11-1-2-16(12-3-7-14(18)8-4-12)13-5-9-15(19)10-6-13/h2-10H,1,11H2 |
| InChIKey | ZCWFINABCDPCBV-UHFFFAOYSA-N |
| Density | 1.253g/cm3 (Cal.) |
|---|---|
| Boiling point | 441.532°C at 760 mmHg (Cal.) |
| Flash point | 312.169°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-(4-Chloro-1-butene-1,1-diyl)bis(4-chlorobenzene) |