|
CAS#: 83929-33-3 Product: 1-Chloro-4-(4-Chloro-1-Phenyl-1-Butenyl)Benzene No suppilers available for the product. |
| Name | 1-Chloro-4-(4-Chloro-1-Phenyl-1-Butenyl)Benzene |
|---|---|
| Synonyms | 1-Chloro-4-[(Z)-4-Chloro-1-Phenyl-But-1-Enyl]Benzene; 1-Chloro-4-(4-Chloro-1-Phenyl-1-Butenyl)Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C16H14Cl2 |
| Molecular Weight | 277.19 |
| CAS Registry Number | 83929-33-3 |
| EINECS | 281-328-3 |
| SMILES | C2=C(\C(C1=CC=CC=C1)=C/CCCl)C=CC(=C2)Cl |
| InChI | 1S/C16H14Cl2/c17-12-4-7-16(13-5-2-1-3-6-13)14-8-10-15(18)11-9-14/h1-3,5-11H,4,12H2/b16-7- |
| InChIKey | BSZZVSUYBVLMIQ-APSNUPSMSA-N |
| Density | 1.171g/cm3 (Cal.) |
|---|---|
| Boiling point | 410.107°C at 760 mmHg (Cal.) |
| Flash point | 194.643°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Chloro-4-(4-Chloro-1-Phenyl-1-Butenyl)Benzene |