|
CAS#: 83929-66-2 Product: 3-(Diethylamino)-4-Methoxybenzenesulphonamide Monohydrochloride No suppilers available for the product. |
| Name | 3-(Diethylamino)-4-Methoxybenzenesulphonamide Monohydrochloride |
|---|---|
| Synonyms | 3-Diethylamino-4-Methoxy-Benzenesulfonamide Hydrochloride; 3-(Diethylamino)-4-Methoxybenzenesulphonamide Monohydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C11H19ClN2O3S |
| Molecular Weight | 294.80 |
| CAS Registry Number | 83929-66-2 |
| EINECS | 281-359-2 |
| SMILES | [H+].C1=C([S](=O)(=O)N)C=CC(=C1N(CC)CC)OC.[Cl-] |
| InChI | 1S/C11H18N2O3S.ClH/c1-4-13(5-2)10-8-9(17(12,14)15)6-7-11(10)16-3;/h6-8H,4-5H2,1-3H3,(H2,12,14,15);1H |
| InChIKey | YRJVOPYVEWGELK-UHFFFAOYSA-N |
| Boiling point | 404°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 198.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(Diethylamino)-4-Methoxybenzenesulphonamide Monohydrochloride |