|
CAS#: 84-90-2 Product: 1,1'-Methylenebisnaphthalene-2-Sulphonic Acid No suppilers available for the product. |
| Name | 1,1'-Methylenebisnaphthalene-2-Sulphonic Acid |
|---|---|
| Synonyms | 1-[(2-Sulfo-1-Naphthyl)Methyl]Naphthalene-2-Sulfonic Acid; 1-[(2-Sulfo-1-Naphthyl)Methyl]-2-Naphthalenesulfonic Acid; 1,1'-Methylenebisnaphthalene-2-Sulphonic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C21H16O6S2 |
| Molecular Weight | 428.47 |
| CAS Registry Number | 84-90-2 |
| EINECS | 201-572-6 |
| SMILES | C2=C1C(=C(C=CC1=CC=C2)[S](=O)(=O)O)CC3=C([S](=O)(=O)O)C=CC4=C3C=CC=C4 |
| InChI | 1S/C21H16O6S2/c22-28(23,24)20-11-9-14-5-1-3-7-16(14)18(20)13-19-17-8-4-2-6-15(17)10-12-21(19)29(25,26)27/h1-12H,13H2,(H,22,23,24)(H,25,26,27) |
| InChIKey | DQBNLFRFALCILS-UHFFFAOYSA-N |
| Density | 1.516g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,1'-Methylenebisnaphthalene-2-Sulphonic Acid |