|
CAS#: 84030-14-8 Product: 4-Chloro-3-Oxo-N-(o-Tolyl)Butyramide No suppilers available for the product. |
| Name | 4-Chloro-3-Oxo-N-(o-Tolyl)Butyramide |
|---|---|
| Synonyms | 4-Chloro-N-(2-Methylphenyl)-3-Oxo-Butanamide; 4-Chloro-3-Keto-N-(2-Methylphenyl)Butyramide; 4-Chloro-3-Oxo-N-(O-Tolyl)Butyramide |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12ClNO2 |
| Molecular Weight | 225.67 |
| CAS Registry Number | 84030-14-8 |
| EINECS | 281-784-3 |
| SMILES | C1=CC=CC(=C1NC(=O)CC(=O)CCl)C |
| InChI | 1S/C11H12ClNO2/c1-8-4-2-3-5-10(8)13-11(15)6-9(14)7-12/h2-5H,6-7H2,1H3,(H,13,15) |
| InChIKey | ONEXMWICVGEHEE-UHFFFAOYSA-N |
| Density | 1.252g/cm3 (Cal.) |
|---|---|
| Boiling point | 398.375°C at 760 mmHg (Cal.) |
| Flash point | 194.731°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-3-Oxo-N-(o-Tolyl)Butyramide |