Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054//+86 13424336463 | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4-Oxa-5-azatetracyclo[6.3.1.02,6.03,10]dodeca-1(12),2,5,7,10-pentaene |
|---|---|
| Molecular Structure | ![CAS#: 84074-73-7, 4-Oxa-5-azatetracyclo[6.3.1.0<sup>2,6</sup>.0<sup>3,10</sup>]dodeca-1(12),2,5,7,10-pentaene](/moreStructures/84074-73-7.gif) |
| Molecular Formula | C10H5NO |
| Molecular Weight | 155.15 |
| CAS Registry Number | 84074-73-7 |
| SMILES | C1C2=CC3=NOC4=C3C(=C2)C=C41 |
| InChI | 1S/C10H5NO/c1-5-2-7-4-6(1)9-8(3-5)11-12-10(7)9/h1,3-4H,2H2 |
| InChIKey | QVMQNUNUECDILQ-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 352.8±21.0°C at 760 mmHg (Cal.) |
| Flash point | 198.5±9.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Oxa-5-azatetracyclo[6.3.1.02,6.03,10]dodeca-1(12),2,5,7,10-pentaene |