|
CAS#: 84145-39-1 Product: 2,5-Bis[(1,3-Dioxobutyl)Phenylamino]Terephthalic Acid No suppilers available for the product. |
| Name | 2,5-Bis[(1,3-Dioxobutyl)Phenylamino]Terephthalic Acid |
|---|---|
| Synonyms | 2,5-Bis[[2-(1,3-Dioxobutyl)Phenyl]Amino]Terephthalic Acid; 2,5-Bis[(2-Acetoacetylphenyl)Amino]Terephthalic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C28H24N2O8 |
| Molecular Weight | 516.51 |
| CAS Registry Number | 84145-39-1 |
| EINECS | 282-265-4 |
| SMILES | C2=C(NC1=C(C(=O)CC(=O)C)C=CC=C1)C(=CC(=C2C(=O)O)NC3=CC=CC=C3C(=O)CC(=O)C)C(=O)O |
| InChI | 1S/C28H24N2O8/c1-15(31)11-25(33)17-7-3-5-9-21(17)29-23-13-20(28(37)38)24(14-19(23)27(35)36)30-22-10-6-4-8-18(22)26(34)12-16(2)32/h3-10,13-14,29-30H,11-12H2,1-2H3,(H,35,36)(H,37,38) |
| InChIKey | MUCMYJOBYCNAKY-UHFFFAOYSA-N |
| Density | 1.396g/cm3 (Cal.) |
|---|---|
| Boiling point | 704.325°C at 760 mmHg (Cal.) |
| Flash point | 379.762°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-Bis[(1,3-Dioxobutyl)Phenylamino]Terephthalic Acid |