|
CAS#: 84170-13-8 Product: 2-Hydroxy-2',3',4,5,5',6'-Hexachlorodiphenyl Ether No suppilers available for the product. |
| Name | 2-Hydroxy-2',3',4,5,5',6'-Hexachlorodiphenyl Ether |
|---|---|
| Synonyms | Brn 4535992; Phenol, 4,5-Dichloro-2-(2,3,5,6-Tetrachlorophenoxy)-; 2-Hydroxy-2',3',4,5,5',6'-Hexachlorodiphenyl Ether |
| Molecular Structure | ![]() |
| Molecular Formula | C12H4Cl6O2 |
| Molecular Weight | 392.88 |
| CAS Registry Number | 84170-13-8 |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)OC2=C(C(=CC(=C2Cl)Cl)Cl)Cl)O |
| InChI | 1S/C12H4Cl6O2/c13-4-2-8(19)9(3-5(4)14)20-12-10(17)6(15)1-7(16)11(12)18/h1-3,19H |
| InChIKey | LHZQBSHJSSXDQI-UHFFFAOYSA-N |
| Density | 1.707g/cm3 (Cal.) |
|---|---|
| Boiling point | 408.581°C at 760 mmHg (Cal.) |
| Flash point | 200.903°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Hydroxy-2',3',4,5,5',6'-Hexachlorodiphenyl Ether |