|
CAS#: 84174-24-3 Product: N-Methyl-N-Nitroso-4-Nitrobenzylamine No suppilers available for the product. |
| Name | N-Methyl-N-Nitroso-4-Nitrobenzylamine |
|---|---|
| Synonyms | N-Methyl-N-(4-Nitrobenzyl)Nitrous Amide; Benzylamine, N-Methyl-P-Nitro-N-Nitroso-; Brn 5530387 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H9N3O3 |
| Molecular Weight | 195.18 |
| CAS Registry Number | 84174-24-3 |
| SMILES | C1=CC(=CC=C1CN(C)N=O)[N+]([O-])=O |
| InChI | 1S/C8H9N3O3/c1-10(9-12)6-7-2-4-8(5-3-7)11(13)14/h2-5H,6H2,1H3 |
| InChIKey | ILORRQUFQKFPBB-UHFFFAOYSA-N |
| Density | 1.3g/cm3 (Cal.) |
|---|---|
| Boiling point | 410.074°C at 760 mmHg (Cal.) |
| Flash point | 201.806°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Methyl-N-Nitroso-4-Nitrobenzylamine |