|
CAS#: 84182-19-4 Product: 9-(3,4-Dioxopentyl)hypoxanthine No suppilers available for the product. |
| Name | 9-(3,4-Dioxopentyl)hypoxanthine |
|---|---|
| Synonyms | 5-(6-Keto-3H-Purin-9-Yl)Pentane-2,3-Dione; 2,3-Pentanedione, 5-(1,6-Dihydro-6-Oxo-9H-Purin-9-Yl)-; 9-(3,4-Dioxopentyl)Hypoxanthine |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10N4O3 |
| Molecular Weight | 234.21 |
| CAS Registry Number | 84182-19-4 |
| SMILES | C1=NC2=C([N]1CCC(=O)C(=O)C)NC=NC2=O |
| InChI | 1S/C10H10N4O3/c1-6(15)7(16)2-3-14-5-13-8-9(14)11-4-12-10(8)17/h4-5H,2-3H2,1H3,(H,11,12,17) |
| InChIKey | WGVLKCJJZFOIBX-UHFFFAOYSA-N |
| Density | 1.536g/cm3 (Cal.) |
|---|---|
| Boiling point | 501.239°C at 760 mmHg (Cal.) |
| Flash point | 256.94°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-(3,4-Dioxopentyl)hypoxanthine |