|
CAS#: 84196-18-9 Product: N2-(1-Benzyl-4-piperidinyl)-1,2-butanediamine No suppilers available for the product. |
| Name | N2-(1-Benzyl-4-piperidinyl)-1,2-butanediamine |
|---|---|
| Synonyms | N2-(1-benzyl-4-piperidyl)butane-1,2-diamine |
| Molecular Structure | ![]() |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 |
| CAS Registry Number | 84196-18-9 |
| EINECS | 282-427-4 |
| SMILES | CCC(CN)NC2CCN(Cc1ccccc1)CC2 |
| InChI | 1S/C16H27N3/c1-2-15(12-17)18-16-8-10-19(11-9-16)13-14-6-4-3-5-7-14/h3-7,15-16,18H,2,8-13,17H2,1H3 |
| InChIKey | QUFUCZKLZXBWAU-UHFFFAOYSA-N |
| Density | 1.027g/cm3 (Cal.) |
|---|---|
| Boiling point | 386.623°C at 760 mmHg (Cal.) |
| Flash point | 187.623°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N2-(1-Benzyl-4-piperidinyl)-1,2-butanediamine |