|
CAS#: 84215-10-1 Product: N-(6-Aminohexyl)-5-chloro-2-naphthalenesulfonamide No suppilers available for the product. |
| Name | N-(6-Aminohexyl)-5-chloro-2-naphthalenesulfonamide |
|---|---|
| Synonyms | NCGC00024558-01; Tocris-0370 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H21ClN2O2S |
| Molecular Weight | 340.87 |
| CAS Registry Number | 84215-10-1 |
| SMILES | C1=CC2=C(C=CC(=C2)S(=O)(=O)NCCCCCCN)C(=C1)Cl |
| InChI | 1S/C16H21ClN2O2S/c17-16-7-5-6-13-12-14(8-9-15(13)16)22(20,21)19-11-4-2-1-3-10-18/h5-9,12,19H,1-4,10-11,18H2 |
| InChIKey | WAEIMOCPASQBSR-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 518.8±56.0°C at 760 mmHg (Cal.) |
| Flash point | 267.6±31.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(6-Aminohexyl)-5-chloro-2-naphthalenesulfonamide |