|
CAS#: 84215-56-5 Product: P,P'-[[(2-hydroxyethyl)imino]bis(methylene)]bis-Phosphonate ammonium salt (1:1) No suppilers available for the product. |
| Name | P,P'-[[(2-hydroxyethyl)imino]bis(methylene)]bis-Phosphonate ammonium salt (1:1) |
|---|---|
| Synonyms | ammonium |
| Molecular Structure | ![]() |
| Molecular Formula | C4H13N2O7P2 |
| Molecular Weight | 263.10 |
| CAS Registry Number | 84215-56-5 |
| EINECS | 282-463-0 |
| SMILES | [NH4+].[O-]P([O-])(=O)CN(CP(=O)([O-])[O-])CCO |
| InChI | 1S/C4H13NO7P2.H3N/c6-2-1-5(3-13(7,8)9)4-14(10,11)12;/h6H,1-4H2,(H2,7,8,9)(H2,10,11,12);1H3/p-3 |
| InChIKey | AOMGKNIQIDLYJH-UHFFFAOYSA-K |
| Boiling point | 646.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 344.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for P,P'-[[(2-hydroxyethyl)imino]bis(methylene)]bis-Phosphonate ammonium salt (1:1) |