|
CAS#: 84260-35-5 Product: 2,2-Diphenyl-1-Thia-3-Aza-2-Silacyclopentane No suppilers available for the product. |
| Name | 2,2-Diphenyl-1-Thia-3-Aza-2-Silacyclopentane |
|---|---|
| Synonyms | Brn 5537793; 1-Thia-3-Aza-2-Silacyclopentane, 2,2-Diphenyl-; 2,2-Diphenyl-1-Thia-3-Aza-2-Silacyclopentane |
| Molecular Structure | ![]() |
| Molecular Formula | C14H15NSSi |
| Molecular Weight | 257.43 |
| CAS Registry Number | 84260-35-5 |
| SMILES | C1=CC=CC=C1[Si]2(SCCN2)C3=CC=CC=C3 |
| InChI | 1S/C14H15NSSi/c1-3-7-13(8-4-1)17(15-11-12-16-17)14-9-5-2-6-10-14/h1-10,15H,11-12H2 |
| InChIKey | MOBMEEBHSLMPCP-UHFFFAOYSA-N |
| Density | 1.16g/cm3 (Cal.) |
|---|---|
| Boiling point | 352.47°C at 760 mmHg (Cal.) |
| Flash point | 166.968°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Diphenyl-1-Thia-3-Aza-2-Silacyclopentane |