|
CAS#: 84260-43-5 Product: 2-(4-Chlorophenyl)-2-Methyl-1-Thia-3-Aza-2-Silacyclopentane No suppilers available for the product. |
| Name | 2-(4-Chlorophenyl)-2-Methyl-1-Thia-3-Aza-2-Silacyclopentane |
|---|---|
| Synonyms | 1-Thia-3-Aza-2-Silacyclopentane, 2-(P-Chlorophenyl)-2-Methyl-; 2-(P-Chlorophenyl)-2-Methyl-1-Thia-3-Aza-2-Silacyclopentane; Brn 5520640 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H12ClNSSi |
| Molecular Weight | 229.80 |
| CAS Registry Number | 84260-43-5 |
| SMILES | C1=CC(=CC=C1[Si]2(SCCN2)C)Cl |
| InChI | 1S/C9H12ClNSSi/c1-13(11-6-7-12-13)9-4-2-8(10)3-5-9/h2-5,11H,6-7H2,1H3 |
| InChIKey | LIARZJZNJIDLJG-UHFFFAOYSA-N |
| Density | 1.214g/cm3 (Cal.) |
|---|---|
| Boiling point | 283.925°C at 760 mmHg (Cal.) |
| Flash point | 125.514°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Chlorophenyl)-2-Methyl-1-Thia-3-Aza-2-Silacyclopentane |