|
CAS#: 84304-91-6 Product: 3-Methyl-7,8,9,10-tetrahydro-6H-benzo[c]chromen-6-one No suppilers available for the product. |
| Name | 3-Methyl-7,8,9,10-tetrahydro-6H-benzo[c]chromen-6-one |
|---|---|
| Synonyms | 3-Methyl-7,8,9,10-tetrahydro-6H-benzo[c]chromen-6-one |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 |
| CAS Registry Number | 84304-91-6 |
| SMILES | O=C\2Oc1cc(ccc1/C3=C/2CCCC3)C |
| InChI | 1S/C14H14O2/c1-9-6-7-11-10-4-2-3-5-12(10)14(15)16-13(11)8-9/h6-8H,2-5H2,1H3 |
| InChIKey | IWWHCYMVNQBJLA-UHFFFAOYSA-N |
| Density | 1.195g/cm3 (Cal.) |
|---|---|
| Boiling point | 388.974°C at 760 mmHg (Cal.) |
| Flash point | 163.61°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-7,8,9,10-tetrahydro-6H-benzo[c]chromen-6-one |