|
CAS#: 84423-97-2 Product: 2-(3-Chloropropyl)-5,6-Bis(4-Dimethylaminophenyl)-1,2,4-Triazin-3-One No suppilers available for the product. |
| Name | 2-(3-Chloropropyl)-5,6-Bis(4-Dimethylaminophenyl)-1,2,4-Triazin-3-One |
|---|---|
| Synonyms | 1,2,4-Triazin-3(2H)-One, 5,6-Bis(4-(Dimethylamino)Phenyl)-2-(3-Chloropropyl)-; 5,6-Bis(4-(Dimethylamino)Phenyl)-2-(3-Chloropropyl)-1,2,4-Triazin-3(2H)-One; Oxo-3 Gamma-Chloropropyl-2 Di(Paradimethoxyaminophenyl) 5,6 As Triazine [French] |
| Molecular Structure | ![]() |
| Molecular Formula | C22H26ClN5O |
| Molecular Weight | 411.93 |
| CAS Registry Number | 84423-97-2 |
| SMILES | C3=C(C1=NN(C(=O)N=C1C2=CC=C(N(C)C)C=C2)CCCCl)C=CC(=C3)N(C)C |
| InChI | 1S/C22H26ClN5O/c1-26(2)18-10-6-16(7-11-18)20-21(17-8-12-19(13-9-17)27(3)4)25-28(15-5-14-23)22(29)24-20/h6-13H,5,14-15H2,1-4H3 |
| InChIKey | MNZFVKPWKWGSBM-UHFFFAOYSA-N |
| Density | 1.191g/cm3 (Cal.) |
|---|---|
| Boiling point | 555.236°C at 760 mmHg (Cal.) |
| Flash point | 289.596°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(3-Chloropropyl)-5,6-Bis(4-Dimethylaminophenyl)-1,2,4-Triazin-3-One |