|
CAS#: 84434-13-9 Product: 2-(1,1-Dimethylethyl)Anthracene-9,10-Dithione No suppilers available for the product. |
| Name | 2-(1,1-Dimethylethyl)Anthracene-9,10-Dithione |
|---|---|
| Synonyms | 2-(1,1-Dimethylethyl)Anthracene-9,10-Dithione |
| Molecular Structure | ![]() |
| Molecular Formula | C18H16S2 |
| Molecular Weight | 296.44 |
| CAS Registry Number | 84434-13-9 |
| EINECS | 282-812-7 |
| SMILES | C1=C(C(C)(C)C)C=CC2=C1C(=S)C3=C(C2=S)C=CC=C3 |
| InChI | 1S/C18H16S2/c1-18(2,3)11-8-9-14-15(10-11)17(20)13-7-5-4-6-12(13)16(14)19/h4-10H,1-3H3 |
| InChIKey | STXMORBGLAAUAL-UHFFFAOYSA-N |
| Density | 1.239g/cm3 (Cal.) |
|---|---|
| Boiling point | 424.118°C at 760 mmHg (Cal.) |
| Flash point | 210.299°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(1,1-Dimethylethyl)Anthracene-9,10-Dithione |