|
CAS#: 84434-16-2 Product: N,N,N-Triethylanilinium Phenylsulphonate No suppilers available for the product. |
| Name | N,N,N-Triethylanilinium Phenylsulphonate |
|---|---|
| Synonyms | Benzenesulfonic Acid; Triethyl-Phenyl-Ammonium; Benzenesulfonic Acid; Triethyl-Phenylammonium; Benzenesulfonic Acid; Triethyl-Phenyl-Azanium |
| Molecular Structure | ![]() |
| Molecular Formula | C18H26NO3S |
| Molecular Weight | 336.47 |
| CAS Registry Number | 84434-16-2 |
| EINECS | 282-815-3 |
| SMILES | C1=C([S](O)(=O)=O)C=CC=C1.C2=C([N+](CC)(CC)CC)C=CC=C2 |
| InChI | 1S/C12H20N.C6H6O3S/c1-4-13(5-2,6-3)12-10-8-7-9-11-12;7-10(8,9)6-4-2-1-3-5-6/h7-11H,4-6H2,1-3H3;1-5H,(H,7,8,9)/q+1; |
| InChIKey | XTHYWQWRORBMLG-UHFFFAOYSA-N |
| Market Analysis Reports |
| List of Reports Available for N,N,N-Triethylanilinium Phenylsulphonate |