|
CAS#: 84434-22-0 Product: 5-Tert-Butyl-4,6-Dinitro-m-Xylene No suppilers available for the product. |
| Name | 5-Tert-Butyl-4,6-Dinitro-m-Xylene |
|---|---|
| Synonyms | 3-Tert-Butyl-1,5-Dimethyl-2,4-Dinitro-Benzene; 5-Tert-Butyl-4,6-Dinitro-M-Xylene |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 |
| CAS Registry Number | 84434-22-0 |
| EINECS | 282-822-1 |
| SMILES | C1=C(C(=C(C(C)(C)C)C(=C1C)[N+]([O-])=O)[N+]([O-])=O)C |
| InChI | 1S/C12H16N2O4/c1-7-6-8(2)11(14(17)18)9(12(3,4)5)10(7)13(15)16/h6H,1-5H3 |
| InChIKey | ZHFGLQLHVTZCGJ-UHFFFAOYSA-N |
| Density | 1.188g/cm3 (Cal.) |
|---|---|
| Boiling point | 357.457°C at 760 mmHg (Cal.) |
| Flash point | 156.715°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Tert-Butyl-4,6-Dinitro-m-Xylene |