|
CAS#: 84434-46-8 Product: 2-Methyl-4-[(2-methylphenyl)diazenyl]-1,3-benzenediamine acetate (1:1) No suppilers available for the product. |
| Name | 2-Methyl-4-[(2-methylphenyl)diazenyl]-1,3-benzenediamine acetate (1:1) |
|---|---|
| Synonyms | 3-(o-tolylazo)toluene-2,6-diamine monoacetate |
| Molecular Structure | ![]() |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 |
| CAS Registry Number | 84434-46-8 |
| EINECS | 282-845-7 |
| SMILES | CC(O)=O.Cc2ccccc2N=Nc1ccc(N)c(C)c1N |
| InChI | 1S/C14H16N4.C2H4O2/c1-9-5-3-4-6-12(9)17-18-13-8-7-11(15)10(2)14(13)16;1-2(3)4/h3-8H,15-16H2,1-2H3;1H3,(H,3,4) |
| InChIKey | UKOFMOZTJCVLDC-UHFFFAOYSA-N |
| Boiling point | 572.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 300.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-4-[(2-methylphenyl)diazenyl]-1,3-benzenediamine acetate (1:1) |