|
CAS#: 84455-46-9 Product: Ammonium 2,3,4-triisopropyl-1-naphthalenesulfonate No suppilers available for the product. |
| Name | Ammonium 2,3,4-triisopropyl-1-naphthalenesulfonate |
|---|---|
| Synonyms | ammonium tris(1-methylethyl)naphthalenesulphonate |
| Molecular Structure | ![]() |
| Molecular Formula | C19H29NO3S |
| Molecular Weight | 351.50 |
| CAS Registry Number | 84455-46-9 |
| EINECS | 282-906-8 |
| SMILES | [NH4+].CC(C)c2c1ccccc1c(c(C(C)C)c2C(C)C)S([O-])(=O)=O |
| InChI | 1S/C19H26O3S.H3N/c1-11(2)16-14-9-7-8-10-15(14)19(23(20,21)22)18(13(5)6)17(16)12(3)4;/h7-13H,1-6H3,(H,20,21,22);1H3 |
| InChIKey | RTXXSGZDJZCXKU-UHFFFAOYSA-N |
| Boiling point | 511.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 263.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ammonium 2,3,4-triisopropyl-1-naphthalenesulfonate |