|
CAS#: 84434-86-6 Product: Dilithium Dodecanedioate No suppilers available for the product. |
| Name | Dilithium Dodecanedioate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C12H20Li2O4 |
| Molecular Weight | 242.17 |
| CAS Registry Number | 84434-86-6 |
| EINECS | 282-879-2 |
| SMILES | C(C([O-])=O)CCCCCCCCCC([O-])=O.[Li+].[Li+] |
| InChI | 1S/C12H22O4.2Li/c13-11(14)9-7-5-3-1-2-4-6-8-10-12(15)16;;/h1-10H2,(H,13,14)(H,15,16);;/q;2*+1/p-2 |
| InChIKey | WZSAITQULFOWSY-UHFFFAOYSA-L |
| Boiling point | 394°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 216.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dilithium Dodecanedioate |