Online Database of Chemicals from Around the World
|
CAS#: 84461-99-4 Product: N-(2,4-Dibromo-6-((cyclohexylmethylamino)methyl)phenyl)-4-hydroxy-3-methoxybenzamide No suppilers available for the product. |
| Name | N-(2,4-Dibromo-6-((cyclohexylmethylamino)methyl)phenyl)-4-hydroxy-3-methoxybenzamide |
|---|---|
| Synonyms | N-[2,4-Dibromo-6-[(Cyclohexyl-Methyl-Amino)Methyl]Phenyl]-4-Hydroxy-3-Methoxy-Benzamide; Br 227; Br-227 |
| Molecular Structure |  |
| Molecular Formula | C22H26Br2N2O3 |
| Molecular Weight | 526.27 |
| CAS Registry Number | 84461-99-4 |
| SMILES | C1=C(Br)C=C(Br)C(=C1CN(C2CCCCC2)C)NC(=O)C3=CC(=C(O)C=C3)OC |
| InChI | 1S/C22H26Br2N2O3/c1-26(17-6-4-3-5-7-17)13-15-10-16(23)12-18(24)21(15)25-22(28)14-8-9-19(27)20(11-14)29-2/h8-12,17,27H,3-7,13H2,1-2H3,(H,25,28) |
| InChIKey | INYWDHXZBXSEMZ-UHFFFAOYSA-N |
| Density | 1.577g/cm3 (Cal.) |
|---|---|
| Boiling point | 547.49°C at 760 mmHg (Cal.) |
| Flash point | 284.912°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2,4-Dibromo-6-((cyclohexylmethylamino)methyl)phenyl)-4-hydroxy-3-methoxybenzamide |