|
CAS#: 84489-09-8 Product: Iminophosphamide No suppilers available for the product. |
| Name | Iminophosphamide |
|---|---|
| Synonyms | Bis(2-Chloroethyl)-(2-Keto-1-Oxa-3-Aza-2$L^{5}-Phosphacyclohex-3-En-2-Yl)Amine; 2H-1,3,2-Oxazaphosphorin-2-Amine, N,N-Bis(2-Chloroethyl)-5,6-Dihydro-, 2-Oxide; Iminocyclophosphamide |
| Molecular Structure | ![]() |
| Molecular Formula | C7H13Cl2N2O2P |
| Molecular Weight | 259.07 |
| CAS Registry Number | 84489-09-8 |
| SMILES | C(N([P]1(OCCC=N1)=O)CCCl)CCl |
| InChI | 1S/C7H13Cl2N2O2P/c8-2-5-11(6-3-9)14(12)10-4-1-7-13-14/h4H,1-3,5-7H2 |
| InChIKey | WCPGXZCOHAERPQ-UHFFFAOYSA-N |
| Density | 1.479g/cm3 (Cal.) |
|---|---|
| Boiling point | 345.63°C at 760 mmHg (Cal.) |
| Flash point | 162.831°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Iminophosphamide |