|
CAS#: 84518-62-7 Product: 2,5-3,4-Dianhydroaltritol No suppilers available for the product. |
| Name | 2,5-3,4-Dianhydroaltritol |
|---|---|
| Synonyms | [(1S,2R,4R,5R)-4-Methylol-3,6-Dioxabicyclo[3.1.0]Hexan-2-Yl]Methanol; 2,5-3,4-Dianhydro-D-Altritol; 2,5-3,4-Dianhydroaltritol |
| Molecular Structure | ![]() |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 |
| CAS Registry Number | 84518-62-7 |
| SMILES | [C@H]12O[C@H]1[C@H](O[C@@H]2CO)CO |
| InChI | 1S/C6H10O4/c7-1-3-5-6(10-5)4(2-8)9-3/h3-8H,1-2H2/t3-,4-,5-,6+/m1/s1 |
| InChIKey | YCRYRWDWBHKSKR-KAZBKCHUSA-N |
| Density | 1.37g/cm3 (Cal.) |
|---|---|
| Boiling point | 310.235°C at 760 mmHg (Cal.) |
| Flash point | 141.425°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-3,4-Dianhydroaltritol |