|
CAS#: 84522-33-8 Product: 2-[2-(4-Isopropylphenyl)Ethyl]Pyridine No suppilers available for the product. |
| Name | 2-[2-(4-Isopropylphenyl)Ethyl]Pyridine |
|---|---|
| Synonyms | 2-[2-(4-Isopropylphenyl)Ethyl]Pyridine; 2-(2-(4-Isopropylphenyl)Ethyl)Pyridine |
| Molecular Structure | ![]() |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.33 |
| CAS Registry Number | 84522-33-8 |
| EINECS | 283-028-8 |
| SMILES | C1=CC=CC(=N1)CCC2=CC=C(C(C)C)C=C2 |
| InChI | 1S/C16H19N/c1-13(2)15-9-6-14(7-10-15)8-11-16-5-3-4-12-17-16/h3-7,9-10,12-13H,8,11H2,1-2H3 |
| InChIKey | XENMERBMHPXJGA-UHFFFAOYSA-N |
| Density | 0.996g/cm3 (Cal.) |
|---|---|
| Boiling point | 311.663°C at 760 mmHg (Cal.) |
| Flash point | 126.699°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[2-(4-Isopropylphenyl)Ethyl]Pyridine |