|
CAS#: 84540-38-5 Product: 1H-Indol-2-Yl Propionate No suppilers available for the product. |
| Name | 1H-Indol-2-Yl Propionate |
|---|---|
| Synonyms | Propanoic Acid 1H-Indol-2-Yl Ester; Propionic Acid 1H-Indol-2-Yl Ester; 1H-Indol-2-Yl Propionate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 |
| CAS Registry Number | 84540-38-5 |
| EINECS | 283-131-8 |
| SMILES | C1=C(OC(=O)CC)[NH]C2=C1C=CC=C2 |
| InChI | 1S/C11H11NO2/c1-2-11(13)14-10-7-8-5-3-4-6-9(8)12-10/h3-7,12H,2H2,1H3 |
| InChIKey | DWBHSHDNGDFNFA-UHFFFAOYSA-N |
| Density | 1.213g/cm3 (Cal.) |
|---|---|
| Boiling point | 349.042°C at 760 mmHg (Cal.) |
| Flash point | 164.895°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1H-Indol-2-Yl Propionate |