|
CAS#: 84540-51-2 Product: 2,4-Dichloro-3-(isopropylideneamino)phenol No suppilers available for the product. |
| Name | 2,4-Dichloro-3-(isopropylideneamino)phenol |
|---|---|
| Synonyms | 2,4-dichlor-3-[(isopropylidene)amino]phenol |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9Cl2NO |
| Molecular Weight | 218.08 |
| CAS Registry Number | 84540-51-2 |
| EINECS | 283-145-4 |
| SMILES | Clc1c(\N=C(/C)C)c(Cl)c(O)cc1 |
| InChI | 1S/C9H9Cl2NO/c1-5(2)12-9-6(10)3-4-7(13)8(9)11/h3-4,13H,1-2H3 |
| InChIKey | JJMJCJRISFLLDK-UHFFFAOYSA-N |
| Density | 1.3g/cm3 (Cal.) |
|---|---|
| Boiling point | 326.659°C at 760 mmHg (Cal.) |
| Flash point | 151.358°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dichloro-3-(isopropylideneamino)phenol |