|
CAS#: 846-35-5 Product: Benzo[e][1]Benzothiopyrano[4,3-b]Indole No suppilers available for the product. |
| Name | Benzo[e][1]Benzothiopyrano[4,3-b]Indole |
|---|---|
| Synonyms | [1]Benzothiopyrano[4,3-B]Benzo[E]Indole; Benzo[E][1]Benzothiopyrano[4,3-B]Indole; Brn 0995071 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H11NS |
| Molecular Weight | 285.36 |
| CAS Registry Number | 846-35-5 |
| SMILES | C4=C3N=C1C(=CSC2=CC=CC=C12)C3=C5C(=C4)C=CC=C5 |
| InChI | 1S/C19H11NS/c1-2-6-13-12(5-1)9-10-16-18(13)15-11-21-17-8-4-3-7-14(17)19(15)20-16/h1-11H |
| InChIKey | ZSAJUPSOOPBWDT-UHFFFAOYSA-N |
| Density | 1.327g/cm3 (Cal.) |
|---|---|
| Boiling point | 472.088°C at 760 mmHg (Cal.) |
| Flash point | 239.311°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzo[e][1]Benzothiopyrano[4,3-b]Indole |