|
CAS#: 84604-55-7 Product: 4-(3-Oxobutyl)Phenyl Formate No suppilers available for the product. |
| Name | 4-(3-Oxobutyl)Phenyl Formate |
|---|---|
| Synonyms | Formic Acid [4-(3-Oxobutyl)Phenyl] Ester; Formic Acid [4-(3-Ketobutyl)Phenyl] Ester; [4-(3-Oxobutyl)Phenyl] Methanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 |
| CAS Registry Number | 84604-55-7 |
| EINECS | 283-336-2 |
| SMILES | C1=C(OC=O)C=CC(=C1)CCC(=O)C |
| InChI | 1S/C11H12O3/c1-9(13)2-3-10-4-6-11(7-5-10)14-8-12/h4-8H,2-3H2,1H3 |
| InChIKey | ZZFMJIBHZZTLPK-UHFFFAOYSA-N |
| Density | 1.107g/cm3 (Cal.) |
|---|---|
| Boiling point | 289.341°C at 760 mmHg (Cal.) |
| Flash point | 124.668°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(3-Oxobutyl)Phenyl Formate |