|
CAS#: 84604-63-7 Product: 1-(3,5,5-Trimethyl-2-Cyclohexen-1-Yl)Propan-1-One No suppilers available for the product. |
| Name | 1-(3,5,5-Trimethyl-2-Cyclohexen-1-Yl)Propan-1-One |
|---|---|
| Synonyms | 1-(3,5,5-Trimethyl-2-Cyclohexen-1-Yl)Propan-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 |
| CAS Registry Number | 84604-63-7 |
| EINECS | 283-345-1 |
| SMILES | C(C(=O)C1C=C(CC(C1)(C)C)C)C |
| InChI | 1S/C12H20O/c1-5-11(13)10-6-9(2)7-12(3,4)8-10/h6,10H,5,7-8H2,1-4H3 |
| InChIKey | KCVALAPENKEXQL-UHFFFAOYSA-N |
| Density | 0.884g/cm3 (Cal.) |
|---|---|
| Boiling point | 238.386°C at 760 mmHg (Cal.) |
| Flash point | 89.966°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3,5,5-Trimethyl-2-Cyclohexen-1-Yl)Propan-1-One |